 |
| 1 . |
|
How many products are possible if a 1,2-disubstituted benzene (C6H4X2) undergoes a third substitution? [Hint]
|
|
| 2 . |
|
What is meant by the term "resonance energy"? [Hint]
|
|
| 3 . |
|
What is the major product obtained from the reaction of Ph-CH2-CH=CH-Ph with HCl? (Ph is a benzene ring.) [Hint]
|
|
| 4 . |
|
How many important resonance contributors does CH2=CH-CH=CH-CH=CH2-CH2(+) have? [Hint]
|
|
| 5 . |
|
How many carbons in aniline (C6H5NH2) possess a partial negative charge? [Hint]
|
|
| 6 . |
|
Which of the following compounds has the greatest resonance energy? [Hint]
|
|
| 7 . |
|
Which of the following is a tertiary benzylic cation? [Hint]
|
|
| 8 . |
|
Which position in the benzyl cation has the least amount of positive charge? [Hint]
|
|
| 9 . |
|
Which of the following molecules does not contain delocalized electrons? [Hint]
|
|
| 10 . |
|
Which of the following compounds has an oxygen atom with a lone pair of electrons that is not involved in resonance? [Hint]
|
|
|
Answer choices in this exercise are randomized and will appear in a different order each time the page is loaded.
|
